C42H42O7S — CID 11636166
[(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)hept-6-ynyl] 4-methylbenzenesulfonate (PubChem CID 11636166) has the molecular formula C42H42O7S and a molecular weight of 690.86 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)hept-6-ynyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)hept-6-ynyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11636166 |
| Molecular Formula | C42H42O7S |
| Molecular Weight | 690.86 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)hept-6-ynyl] 4-methylbenzenesulfonate |
| SMILES | C#C[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COS(=O)(=O)c1ccc(C)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C42H42O7S/c1-3-39(45-28-34-16-8-4-9-17-34)41(47-30-36-20-12-6-13-21-36)42(48-31-37-22-14-7-15-23-37)40(46-29-35-18-10-5-11-19-35)32-49-50(43,44)38-26-24-33(2)25-27-38/h1,4-27,39-42H,28-32H2,2H3/t39-,40-,41-,42-/m1/s1 |
| InChIKey | QRLGKUPNEHBNRN-BMGLKWEPSA-N |
| XLogP | 7.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.86 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|