C34H42O11S2 — CID 50924817
diethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate (PubChem CID 50924817) has the molecular formula C34H42O11S2 and a molecular weight of 690.83 g/mol. Its IUPAC name is diethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate.
| Compound Name | diethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate |
|---|---|
| PubChem CID | 50924817 |
| Molecular Formula | C34H42O11S2 |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.22 |
| IUPAC Name | diethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@@H]([C@H](OCc1ccccc1)[C@@H](COS(C)(=O)=O)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C34H42O11S2/c1-5-41-33(35)29(34(36)42-6-2)21-31(47(39,40)28-19-17-25(3)18-20-28)32(44-23-27-15-11-8-12-16-27)30(24-45-46(4,37)38)43-22-26-13-9-7-10-14-26/h7-20,29-32H,5-6,21-24H2,1-4H3/t30-,31+,32-/m1/s1 |
| InChIKey | GTGHFXREGYTNJI-YKILCQELSA-N |
| XLogP | 4.42 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|