C42H39NO7S — CID 15385592
[(E,2S,3S,4S)-6-isocyano-6-(4-methylphenyl)sulfonyl-2,3,4-tris(phenylmethoxy)hex-5-enyl] benzoate (PubChem CID 15385592) has the molecular formula C42H39NO7S and a molecular weight of 701.84 g/mol. Its IUPAC name is [(E,2S,3S,4S)-6-isocyano-6-(4-methylphenyl)sulfonyl-2,3,4-tris(phenylmethoxy)hex-5-enyl] benzoate.
| Compound Name | [(E,2S,3S,4S)-6-isocyano-6-(4-methylphenyl)sulfonyl-2,3,4-tris(phenylmethoxy)hex-5-enyl] benzoate |
|---|---|
| PubChem CID | 15385592 |
| Molecular Formula | C42H39NO7S |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | [(E,2S,3S,4S)-6-isocyano-6-(4-methylphenyl)sulfonyl-2,3,4-tris(phenylmethoxy)hex-5-enyl] benzoate |
| SMILES | [C-]#[N+]/C(=C\[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](COC(=O)c1ccccc1)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C42H39NO7S/c1-32-23-25-37(26-24-32)51(45,46)40(43-2)27-38(47-28-33-15-7-3-8-16-33)41(49-30-35-19-11-5-12-20-35)39(48-29-34-17-9-4-10-18-34)31-50-42(44)36-21-13-6-14-22-36/h3-27,38-39,41H,28-31H2,1H3/b40-27+/t38-,39-,41-/m0/s1 |
| InChIKey | HSAFNRULYAHOCW-BJEDRWNWSA-N |
| XLogP | 8.14 |
| TPSA | 92.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|