C22H28O8S2 — CID 134840013
[(2R,3R)-4-(methylsulfonyloxymethyl)-2,3-bis(phenylmethoxy)pent-4-enyl] methanesulfonate (PubChem CID 134840013) has the molecular formula C22H28O8S2 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(2R,3R)-4-(methylsulfonyloxymethyl)-2,3-bis(phenylmethoxy)pent-4-enyl] methanesulfonate.
| Compound Name | [(2R,3R)-4-(methylsulfonyloxymethyl)-2,3-bis(phenylmethoxy)pent-4-enyl] methanesulfonate |
|---|---|
| PubChem CID | 134840013 |
| Molecular Formula | C22H28O8S2 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | [(2R,3R)-4-(methylsulfonyloxymethyl)-2,3-bis(phenylmethoxy)pent-4-enyl] methanesulfonate |
| SMILES | C=C(COS(C)(=O)=O)[C@@H](OCc1ccccc1)[C@@H](COS(C)(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28O8S2/c1-18(14-29-31(2,23)24)22(28-16-20-12-8-5-9-13-20)21(17-30-32(3,25)26)27-15-19-10-6-4-7-11-19/h4-13,21-22H,1,14-17H2,2-3H3/t21-,22-/m1/s1 |
| InChIKey | VDVKQBVJKHKYBR-FGZHOGPDSA-N |
| XLogP | 2.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|