C43H49NO7SSi — CID 134877469
[(2S,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate (PubChem CID 134877469) has the molecular formula C43H49NO7SSi and a molecular weight of 752.02 g/mol. Its IUPAC name is [(2S,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate.
| Compound Name | [(2S,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 134877469 |
| Molecular Formula | C43H49NO7SSi |
| Molecular Weight | 752.02 g/mol |
| Exact Mass | 751.30 |
| IUPAC Name | [(2S,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](O/N=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](COS(C)(=O)=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H49NO7SSi/c1-43(2,3)53(38-26-16-8-17-27-38,39-28-18-9-19-29-39)51-44-30-40(47-31-35-20-10-5-11-21-35)42(49-33-37-24-14-7-15-25-37)41(34-50-52(4,45)46)48-32-36-22-12-6-13-23-36/h5-30,40-42H,31-34H2,1-4H3/b44-30+/t40-,41+,42+/m1/s1 |
| InChIKey | GXAHKSPLGAMHFP-IDFPXRRMSA-N |
| XLogP | 7.28 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.02 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|