C22H30O8S2 — CID 11842784
[(3R,4S,5S)-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)hexyl] methanesulfonate (PubChem CID 11842784) has the molecular formula C22H30O8S2 and a molecular weight of 486.61 g/mol. Its IUPAC name is [(3R,4S,5S)-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)hexyl] methanesulfonate.
| Compound Name | [(3R,4S,5S)-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)hexyl] methanesulfonate |
|---|---|
| PubChem CID | 11842784 |
| Molecular Formula | C22H30O8S2 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [(3R,4S,5S)-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)hexyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)[C@@H](OCc1ccccc1)[C@@H](CCOS(C)(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H30O8S2/c1-18(30-32(3,25)26)22(28-17-20-12-8-5-9-13-20)21(14-15-29-31(2,23)24)27-16-19-10-6-4-7-11-19/h4-13,18,21-22H,14-17H2,1-3H3/t18-,21+,22+/m0/s1 |
| InChIKey | VMRZUQBMFXRRPT-VLCRHTCISA-N |
| XLogP | 2.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|