C24H32O4S — CID 71733858
[(E,2R,6R)-2,6-dimethyl-8-phenylmethoxyoct-4-enyl] 4-methylbenzenesulfonate (PubChem CID 71733858) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is [(E,2R,6R)-2,6-dimethyl-8-phenylmethoxyoct-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2R,6R)-2,6-dimethyl-8-phenylmethoxyoct-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71733858 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [(E,2R,6R)-2,6-dimethyl-8-phenylmethoxyoct-4-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)C/C=C/[C@H](C)CCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32O4S/c1-20(16-17-27-19-23-10-5-4-6-11-23)8-7-9-22(3)18-28-29(25,26)24-14-12-21(2)13-15-24/h4-8,10-15,20,22H,9,16-19H2,1-3H3/b8-7+/t20-,22+/m0/s1 |
| InChIKey | MPWBXDCDHPNMRT-GYLJRODDSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|