About O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate
O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate (PubChem CID 131739540) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate.
Molecular Properties
| Compound Name | O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate |
| PubChem CID | 131739540 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate |
| SMILES | CC(=S)OC1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C16H17NO3S/c1-10(21)20-12-8-6-11(7-9-12)17-15(18)13-4-2-3-5-14(13)16(17)19/h2-5,11-12H,6-9H2,1H3 |
| InChIKey | XWPSZYCASBWKLC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate?
The IUPAC name of O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate (CID 131739540) is O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate.
What is the SMILES notation for O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate?
The canonical SMILES for O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate is CC(=S)OC1CCC(N2C(=O)c3ccccc3C2=O)CC1.
What is the InChIKey of O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate?
The InChIKey is XWPSZYCASBWKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-10(21)20-12-8-6-11(7-9-12)17-15(18)13-4-2-3-5-14(13)16(17)19/h2-5,11-12H,6-9H2,1H3.
What are the key properties of O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate?
O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate has a molecular weight of 303.38 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl] ethanethioate is sourced from PubChem (CID 131739540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).