C22H25NO4 — CID 174151514
2-[(6S)-5,8-dimethoxy-6,7-dimethyl-1,2,3,4,6,7-hexahydronaphthalen-2-yl]isoindole-1,3-dione (PubChem CID 174151514) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[(6S)-5,8-dimethoxy-6,7-dimethyl-1,2,3,4,6,7-hexahydronaphthalen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(6S)-5,8-dimethoxy-6,7-dimethyl-1,2,3,4,6,7-hexahydronaphthalen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 174151514 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[(6S)-5,8-dimethoxy-6,7-dimethyl-1,2,3,4,6,7-hexahydronaphthalen-2-yl]isoindole-1,3-dione |
| SMILES | COC1=C2CC(N3C(=O)c4ccccc4C3=O)CCC2=C(OC)[C@@H](C)C1C |
| InChI | InChI=1S/C22H25NO4/c1-12-13(2)20(27-4)18-11-14(9-10-15(18)19(12)26-3)23-21(24)16-7-5-6-8-17(16)22(23)25/h5-8,12-14H,9-11H2,1-4H3/t12-,13?,14?/m0/s1 |
| InChIKey | UHZFVXXKZLIRRX-HSBZDZAISA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|