C17H15N3O3 — CID 162782736
2-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-7-yl)isoindole-1,3-dione (PubChem CID 162782736) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-7-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-7-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162782736 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-7-yl)isoindole-1,3-dione |
| SMILES | Cn1nc2c(cc1=O)CCC(N1C(=O)c3ccccc3C1=O)C2 |
| InChI | InChI=1S/C17H15N3O3/c1-19-15(21)8-10-6-7-11(9-14(10)18-19)20-16(22)12-4-2-3-5-13(12)17(20)23/h2-5,8,11H,6-7,9H2,1H3 |
| InChIKey | CHNDPNJWVOOYHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|