C16H13N3O3 — CID 162782737
2-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)isoindole-1,3-dione (PubChem CID 162782737) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)isoindole-1,3-dione.
| Compound Name | 2-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162782737 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCc2cc(=O)[nH]nc2C1 |
| InChI | InChI=1S/C16H13N3O3/c20-14-7-9-5-6-10(8-13(9)17-18-14)19-15(21)11-3-1-2-4-12(11)16(19)22/h1-4,7,10H,5-6,8H2,(H,18,20) |
| InChIKey | AXRNRVOIOBNQJM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|