C16H17N3O3 — CID 70858785
benzyl N-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)carbamate (PubChem CID 70858785) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is benzyl N-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)carbamate.
| Compound Name | benzyl N-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)carbamate |
|---|---|
| PubChem CID | 70858785 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | benzyl N-(3-oxo-5,6,7,8-tetrahydro-2H-cinnolin-7-yl)carbamate |
| SMILES | O=C(NC1CCc2cc(=O)[nH]nc2C1)OCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O3/c20-15-8-12-6-7-13(9-14(12)18-19-15)17-16(21)22-10-11-4-2-1-3-5-11/h1-5,8,13H,6-7,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | DGKCMSKAKGINOV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |