C15H19N5O2 — CID 174943242
benzyl N-[(3-amino-4,5,6,7-tetrahydro-1H-indazol-5-yl)amino]carbamate (PubChem CID 174943242) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is benzyl N-[(3-amino-4,5,6,7-tetrahydro-1H-indazol-5-yl)amino]carbamate.
| Compound Name | benzyl N-[(3-amino-4,5,6,7-tetrahydro-1H-indazol-5-yl)amino]carbamate |
|---|---|
| PubChem CID | 174943242 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | benzyl N-[(3-amino-4,5,6,7-tetrahydro-1H-indazol-5-yl)amino]carbamate |
| SMILES | Nc1n[nH]c2c1CC(NNC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C15H19N5O2/c16-14-12-8-11(6-7-13(12)18-19-14)17-20-15(21)22-9-10-4-2-1-3-5-10/h1-5,11,17H,6-9H2,(H,20,21)(H3,16,18,19) |
| InChIKey | LVUZEEGQLNNCMZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|