C20H21NO3 — CID 176717224
2-(8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl)isoindole-1,3-dione (PubChem CID 176717224) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 176717224 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(8,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl)isoindole-1,3-dione |
| SMILES | CC1CC(=O)C=C2CCC(N3C(=O)c4ccccc4C3=O)CC21C |
| InChI | InChI=1S/C20H21NO3/c1-12-9-15(22)10-13-7-8-14(11-20(12,13)2)21-18(23)16-5-3-4-6-17(16)19(21)24/h3-6,10,12,14H,7-9,11H2,1-2H3 |
| InChIKey | RQHUZSFQBLSKPN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|