C31H48O3 — CID 158494987
(4R,4aS)-4,4a-dimethyl-6-(2-methyloxiran-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one;(4R,4aS)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one;methane (PubChem CID 158494987) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is (4R,4aS)-4,4a-dimethyl-6-(2-methyloxiran-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one;(4R,4aS)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one;methane.
| Compound Name | (4R,4aS)-4,4a-dimethyl-6-(2-methyloxiran-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one;(4R,4aS)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one;methane |
|---|---|
| PubChem CID | 158494987 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | (4R,4aS)-4,4a-dimethyl-6-(2-methyloxiran-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one;(4R,4aS)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one;methane |
| SMILES | C.C=C(C)C1CCC2=CC(=O)C[C@@H](C)[C@]2(C)C1.C[C@@H]1CC(=O)C=C2CCC(C3(C)CO3)C[C@]21C |
| InChI | InChI=1S/C15H22O2.C15H22O.CH4/c1-10-6-13(16)7-11-4-5-12(8-14(10,11)2)15(3)9-17-15;1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12;/h7,10,12H,4-6,8-9H2,1-3H3;8,11-12H,1,5-7,9H2,2-4H3;1H4/t10-,12?,14+,15?;11-,12?,15+;/m11./s1 |
| InChIKey | HJDXNPLHHIEXGS-NRWHBSBESA-N |
| XLogP | 7.66 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|