C14H22O — CID 527185
1-(8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)ethanone (PubChem CID 527185) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)ethanone.
| Compound Name | 1-(8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 527185 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1-(8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)ethanone |
| SMILES | CC(=O)C1CCC2=CCCC(C)C2(C)C1 |
| InChI | InChI=1S/C14H22O/c1-10-5-4-6-13-8-7-12(11(2)15)9-14(10,13)3/h6,10,12H,4-5,7-9H2,1-3H3 |
| InChIKey | XVYRIAXPYGHTSG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|