C16H28O — CID 138732656
(3R,4aS,5R)-3-(2-methoxypropan-2-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene (PubChem CID 138732656) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (3R,4aS,5R)-3-(2-methoxypropan-2-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
| Compound Name | (3R,4aS,5R)-3-(2-methoxypropan-2-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 138732656 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (3R,4aS,5R)-3-(2-methoxypropan-2-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | COC(C)(C)[C@@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C16H28O/c1-12-7-6-8-13-9-10-14(11-16(12,13)4)15(2,3)17-5/h8,12,14H,6-7,9-11H2,1-5H3/t12-,14-,16+/m1/s1 |
| InChIKey | XBBXJYRXNDSEQZ-XPKDYRNWSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|