C37H49NO5Si2 — CID 131744158
2-[(1R,2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxycyclopentyl]isoindole-1,3-dione (PubChem CID 131744158) has the molecular formula C37H49NO5Si2 and a molecular weight of 643.97 g/mol. Its IUPAC name is 2-[(1R,2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxycyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxycyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 131744158 |
| Molecular Formula | C37H49NO5Si2 |
| Molecular Weight | 643.97 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | 2-[(1R,2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxycyclopentyl]isoindole-1,3-dione |
| SMILES | CO[C@@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H49NO5Si2/c1-36(2,3)44(8,9)42-25-26-24-31(38-34(39)29-22-16-17-23-30(29)35(38)40)33(41-7)32(26)43-45(37(4,5)6,27-18-12-10-13-19-27)28-20-14-11-15-21-28/h10-23,26,31-33H,24-25H2,1-9H3/t26-,31-,32-,33+/m1/s1 |
| InChIKey | DHJQFHQLUHIECE-SQOZHWTMSA-N |
| XLogP | 6.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.97 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|