C27H36O4Si — CID 164935034
[(2'R,3aR,5S,6S)-2'-ethyl-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,1'-cyclopropane]-6-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 164935034) has the molecular formula C27H36O4Si and a molecular weight of 452.67 g/mol. Its IUPAC name is [(2'R,3aR,5S,6S)-2'-ethyl-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,1'-cyclopropane]-6-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2'R,3aR,5S,6S)-2'-ethyl-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,1'-cyclopropane]-6-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 164935034 |
| Molecular Formula | C27H36O4Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [(2'R,3aR,5S,6S)-2'-ethyl-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,1'-cyclopropane]-6-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC[C@@H]1C[C@]12O[C@@H]1OC(C)(C)OC1[C@@H]2O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O4Si/c1-7-19-18-27(19)23(22-24(30-27)29-26(5,6)28-22)31-32(25(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,19,22-24H,7,18H2,1-6H3/t19-,22?,23+,24+,27+/m1/s1 |
| InChIKey | OPMVKFDBGGFJCE-FNSYDFSCSA-N |
| XLogP | 4.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|