C23H33NO2Si — CID 102172046
[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-diphenylmethanol (PubChem CID 102172046) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-diphenylmethanol.
| Compound Name | [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 102172046 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-diphenylmethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN[C@H](C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H33NO2Si/c1-22(2,3)27(4,5)26-20-16-21(24-17-20)23(25,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-21,24-25H,16-17H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | JJNFQHDKKWZYEH-RTWAWAEBSA-N |
| XLogP | 4.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|