C37H35NO2 — CID 102310192
1-[(2R,3R)-1-benzyl-2-phenylazetidin-3-yl]-2-trityloxyethanol (PubChem CID 102310192) has the molecular formula C37H35NO2 and a molecular weight of 525.69 g/mol. Its IUPAC name is 1-[(2R,3R)-1-benzyl-2-phenylazetidin-3-yl]-2-trityloxyethanol.
| Compound Name | 1-[(2R,3R)-1-benzyl-2-phenylazetidin-3-yl]-2-trityloxyethanol |
|---|---|
| PubChem CID | 102310192 |
| Molecular Formula | C37H35NO2 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 1-[(2R,3R)-1-benzyl-2-phenylazetidin-3-yl]-2-trityloxyethanol |
| SMILES | OC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H]1CN(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C37H35NO2/c39-35(34-27-38(26-29-16-6-1-7-17-29)36(34)30-18-8-2-9-19-30)28-40-37(31-20-10-3-11-21-31,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-25,34-36,39H,26-28H2/t34-,35?,36-/m0/s1 |
| InChIKey | IWEXSHNRWAYZOV-KSXVSBSBSA-N |
| XLogP | 7.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|