C27H31NO4 — CID 134865977
(2R,3S,4R)-1-benzyl-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]pyrrolidine-3,4-diol (PubChem CID 134865977) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2R,3S,4R)-1-benzyl-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]pyrrolidine-3,4-diol.
| Compound Name | (2R,3S,4R)-1-benzyl-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 134865977 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (2R,3S,4R)-1-benzyl-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]pyrrolidine-3,4-diol |
| SMILES | O[C@H]1[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)N(Cc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C27H31NO4/c29-24-17-28(16-21-10-4-1-5-11-21)26(27(24)30)25(32-19-23-14-8-3-9-15-23)20-31-18-22-12-6-2-7-13-22/h1-15,24-27,29-30H,16-20H2/t24-,25-,26+,27-/m1/s1 |
| InChIKey | AIRKMAKVZSAINF-JVYGEBFASA-N |
| XLogP | 3.39 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |