C44H68O7Si2 — CID 11125575
(3R,4R,6R,7S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyl-3,7-bis(phenylmethoxy)octan-2-one (PubChem CID 11125575) has the molecular formula C44H68O7Si2 and a molecular weight of 765.19 g/mol. Its IUPAC name is (3R,4R,6R,7S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyl-3,7-bis(phenylmethoxy)octan-2-one.
| Compound Name | (3R,4R,6R,7S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyl-3,7-bis(phenylmethoxy)octan-2-one |
|---|---|
| PubChem CID | 11125575 |
| Molecular Formula | C44H68O7Si2 |
| Molecular Weight | 765.19 g/mol |
| Exact Mass | 764.45 |
| IUPAC Name | (3R,4R,6R,7S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyl-3,7-bis(phenylmethoxy)octan-2-one |
| SMILES | COc1ccc(CO[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)OCc2ccccc2)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)C(C)=O)cc1 |
| InChI | InChI=1S/C44H68O7Si2/c1-33(45)39(48-30-35-23-19-16-20-24-35)41(51-53(13,14)43(5,6)7)44(8,9)40(49-31-36-25-27-37(46-10)28-26-36)38(32-50-52(11,12)42(2,3)4)47-29-34-21-17-15-18-22-34/h15-28,38-41H,29-32H2,1-14H3/t38-,39-,40-,41-/m0/s1 |
| InChIKey | HHKUGVQJHQQDEL-MFDNGWNGSA-N |
| XLogP | 10.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.19 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|