C39H53ClO7Si — CID 101042600
(2R,3R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-2,6-bis(phenylmethoxy)nonanal (PubChem CID 101042600) has the molecular formula C39H53ClO7Si and a molecular weight of 697.39 g/mol. Its IUPAC name is (2R,3R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-2,6-bis(phenylmethoxy)nonanal.
| Compound Name | (2R,3R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-2,6-bis(phenylmethoxy)nonanal |
|---|---|
| PubChem CID | 101042600 |
| Molecular Formula | C39H53ClO7Si |
| Molecular Weight | 697.39 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | (2R,3R,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-2,6-bis(phenylmethoxy)nonanal |
| SMILES | COc1ccc(CO[C@@H]([C@H](C=O)OCc2ccccc2)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)C(=O)[C@H](C)Cl)cc1 |
| InChI | InChI=1S/C39H53ClO7Si/c1-28(40)34(42)35(45-26-30-18-14-11-15-19-30)37(47-48(8,9)38(2,3)4)39(5,6)36(46-27-31-20-22-32(43-7)23-21-31)33(24-41)44-25-29-16-12-10-13-17-29/h10-24,28,33,35-37H,25-27H2,1-9H3/t28-,33-,35-,36-,37-/m0/s1 |
| InChIKey | BNAPJBUBOVUMON-DKBCTHTMSA-N |
| XLogP | 8.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.39 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|