C32H47BrO6Si — CID 10532125
(3S,5R,6R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-6-phenylmethoxynonanal (PubChem CID 10532125) has the molecular formula C32H47BrO6Si and a molecular weight of 635.71 g/mol. Its IUPAC name is (3S,5R,6R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-6-phenylmethoxynonanal.
| Compound Name | (3S,5R,6R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-6-phenylmethoxynonanal |
|---|---|
| PubChem CID | 10532125 |
| Molecular Formula | C32H47BrO6Si |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | (3S,5R,6R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-7-oxo-6-phenylmethoxynonanal |
| SMILES | COc1ccc(CO[C@@H]([C@@H](OCc2ccccc2)C(=O)C(C)Br)C(C)(C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H47BrO6Si/c1-23(33)28(35)29(37-21-24-13-11-10-12-14-24)30(38-22-25-15-17-26(36-7)18-16-25)32(5,6)27(19-20-34)39-40(8,9)31(2,3)4/h10-18,20,23,27,29-30H,19,21-22H2,1-9H3/t23?,27-,29-,30-/m0/s1 |
| InChIKey | AZJHQJLQPCGZAX-YISNZFHHSA-N |
| XLogP | 7.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|