C44H62O8Si — CID 71154073
(E,9R,12R)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione (PubChem CID 71154073) has the molecular formula C44H62O8Si and a molecular weight of 747.06 g/mol. Its IUPAC name is (E,9R,12R)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione.
| Compound Name | (E,9R,12R)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione |
|---|---|
| PubChem CID | 71154073 |
| Molecular Formula | C44H62O8Si |
| Molecular Weight | 747.06 g/mol |
| Exact Mass | 746.42 |
| IUPAC Name | (E,9R,12R)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione |
| SMILES | COc1ccc(COC/C=C/C(C)(C)C(=O)CC(=O)C[C@@H](CC(OCc2ccc(OC)cc2)[C@@H](C)OCc2ccccc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C44H62O8Si/c1-33(50-31-34-15-12-11-13-16-34)41(51-32-36-19-23-39(48-8)24-20-36)29-40(52-53(9,10)43(2,3)4)27-37(45)28-42(46)44(5,6)25-14-26-49-30-35-17-21-38(47-7)22-18-35/h11-25,33,40-41H,26-32H2,1-10H3/b25-14+/t33-,40+,41?/m1/s1 |
| InChIKey | DTXGXKVJZHNJPV-LXBOEXSOSA-N |
| XLogP | 9.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.06 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|