C38H48O8 — CID 11192974
(E,9R,11R,12R)-9-hydroxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione (PubChem CID 11192974) has the molecular formula C38H48O8 and a molecular weight of 632.79 g/mol. Its IUPAC name is (E,9R,11R,12R)-9-hydroxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione.
| Compound Name | (E,9R,11R,12R)-9-hydroxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione |
|---|---|
| PubChem CID | 11192974 |
| Molecular Formula | C38H48O8 |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | (E,9R,11R,12R)-9-hydroxy-1,11-bis[(4-methoxyphenyl)methoxy]-4,4-dimethyl-12-phenylmethoxytridec-2-ene-5,7-dione |
| SMILES | COc1ccc(COC/C=C/C(C)(C)C(=O)CC(=O)C[C@H](O)C[C@@H](OCc2ccc(OC)cc2)[C@@H](C)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H48O8/c1-28(45-26-29-10-7-6-8-11-29)36(46-27-31-14-18-35(43-5)19-15-31)23-32(39)22-33(40)24-37(41)38(2,3)20-9-21-44-25-30-12-16-34(42-4)17-13-30/h6-20,28,32,36,39H,21-27H2,1-5H3/b20-9+/t28-,32+,36-/m1/s1 |
| InChIKey | IHBFKFYDYICZDJ-NVMKGFTOSA-N |
| XLogP | 6.66 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|