C33H38O6 — CID 10962482
methyl (5S,7S)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-3-oxo-10,10-diphenyldec-9-enoate (PubChem CID 10962482) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is methyl (5S,7S)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-3-oxo-10,10-diphenyldec-9-enoate.
| Compound Name | methyl (5S,7S)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-3-oxo-10,10-diphenyldec-9-enoate |
|---|---|
| PubChem CID | 10962482 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | methyl (5S,7S)-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-3-oxo-10,10-diphenyldec-9-enoate |
| SMILES | COC(=O)CC(=O)C[C@@H](O)C[C@H](OCc1ccc(OC)cc1)C(C)(C)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38O6/c1-33(2,22-30(25-11-7-5-8-12-25)26-13-9-6-10-14-26)31(20-27(34)19-28(35)21-32(36)38-4)39-23-24-15-17-29(37-3)18-16-24/h5-18,22,27,31,34H,19-21,23H2,1-4H3/t27-,31+/m1/s1 |
| InChIKey | BGRWTYMZIYRFJC-JOMNFKBKSA-N |
| XLogP | 6.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|