C21H24O4 — CID 139615374
methyl 5,5-bis(4-methoxyphenyl)-3-methylpent-4-enoate (PubChem CID 139615374) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 5,5-bis(4-methoxyphenyl)-3-methylpent-4-enoate.
| Compound Name | methyl 5,5-bis(4-methoxyphenyl)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 139615374 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl 5,5-bis(4-methoxyphenyl)-3-methylpent-4-enoate |
| SMILES | COC(=O)CC(C)C=C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H24O4/c1-15(14-21(22)25-4)13-20(16-5-9-18(23-2)10-6-16)17-7-11-19(24-3)12-8-17/h5-13,15H,14H2,1-4H3 |
| InChIKey | FNNZFBDAEATGBI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |