C44H57NO5Si — CID 100948991
(3R,5S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-N,10,10-triphenyldec-9-enamide (PubChem CID 100948991) has the molecular formula C44H57NO5Si and a molecular weight of 708.03 g/mol. Its IUPAC name is (3R,5S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-N,10,10-triphenyldec-9-enamide.
| Compound Name | (3R,5S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-N,10,10-triphenyldec-9-enamide |
|---|---|
| PubChem CID | 100948991 |
| Molecular Formula | C44H57NO5Si |
| Molecular Weight | 708.03 g/mol |
| Exact Mass | 707.40 |
| IUPAC Name | (3R,5S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-N,10,10-triphenyldec-9-enamide |
| SMILES | COc1ccc(CO[C@@H](C[C@H](O)C[C@H](CC(=O)Nc2ccccc2)O[Si](C)(C)C(C)(C)C)C(C)(C)C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H57NO5Si/c1-43(2,3)51(7,8)50-39(30-42(47)45-36-22-16-11-17-23-36)28-37(46)29-41(49-32-33-24-26-38(48-6)27-25-33)44(4,5)31-40(34-18-12-9-13-19-34)35-20-14-10-15-21-35/h9-27,31,37,39,41,46H,28-30,32H2,1-8H3,(H,45,47)/t37-,39-,41+/m1/s1 |
| InChIKey | CMIHFKUMEIWBCA-QNLNERIASA-N |
| XLogP | 10.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.03 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|