C34H49NO7 — CID 121460479
benzyl (2S)-3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 121460479) has the molecular formula C34H49NO7 and a molecular weight of 583.77 g/mol. Its IUPAC name is benzyl (2S)-3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | benzyl (2S)-3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 121460479 |
| Molecular Formula | C34H49NO7 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | benzyl (2S)-3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(CO[C@@H](C)[C@@H](/C=C/COC[C@H](NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)CCC(C)C)cc1 |
| InChI | InChI=1S/C34H49NO7/c1-25(2)15-18-29(26(3)40-22-28-16-19-30(38-7)20-17-28)14-11-21-39-24-31(35-33(37)42-34(4,5)6)32(36)41-23-27-12-9-8-10-13-27/h8-14,16-17,19-20,25-26,29,31H,15,18,21-24H2,1-7H3,(H,35,37)/b14-11+/t26-,29-,31-/m0/s1 |
| InChIKey | YAUMHYPNPSYQGI-GAPNJZOBSA-N |
| XLogP | 6.86 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|