C27H43NO7 — CID 121455470
3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 121455470) has the molecular formula C27H43NO7 and a molecular weight of 493.64 g/mol. Its IUPAC name is 3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 121455470 |
| Molecular Formula | C27H43NO7 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 3-[(E,4R)-4-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-7-methyloct-2-enoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COc1ccc(CO[C@@H](C)[C@@H](/C=C/COCC(NC(=O)OC(C)(C)C)C(=O)O)CCC(C)C)cc1 |
| InChI | InChI=1S/C27H43NO7/c1-19(2)10-13-22(20(3)34-17-21-11-14-23(32-7)15-12-21)9-8-16-33-18-24(25(29)30)28-26(31)35-27(4,5)6/h8-9,11-12,14-15,19-20,22,24H,10,13,16-18H2,1-7H3,(H,28,31)(H,29,30)/b9-8+/t20-,22-,24?/m0/s1 |
| InChIKey | NDNOKLUACNQBCG-DETJYSDKSA-N |
| XLogP | 5.20 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|