C65H72O11Si — CID 21020176
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate (PubChem CID 21020176) has the molecular formula C65H72O11Si and a molecular weight of 1057.37 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 21020176 |
| Molecular Formula | C65H72O11Si |
| Molecular Weight | 1057.37 g/mol |
| Exact Mass | 1056.48 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate |
| SMILES | COc1ccc(COC2C(OC(=O)c3ccccc3)C(C)OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2OC2OC(C)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C65H72O11Si/c1-46-57(68-41-48-25-13-7-14-26-48)60(69-42-49-27-15-8-16-28-49)62(71-43-50-29-17-9-18-30-50)64(74-46)76-59-56(45-72-77(65(3,4)5,54-33-21-11-22-34-54)55-35-23-12-24-36-55)73-47(2)58(75-63(66)52-31-19-10-20-32-52)61(59)70-44-51-37-39-53(67-6)40-38-51/h7-40,46-47,56-62,64H,41-45H2,1-6H3 |
| InChIKey | LESMAWAXPPGSQG-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.37 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|