C57H64O10Si — CID 21020179
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate (PubChem CID 21020179) has the molecular formula C57H64O10Si and a molecular weight of 937.22 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 21020179 |
| Molecular Formula | C57H64O10Si |
| Molecular Weight | 937.22 g/mol |
| Exact Mass | 936.43 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methyl-5-[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-3-yl] benzoate |
| SMILES | CC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(OC2OC(C)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)C(O)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C57H64O10Si/c1-40-50(66-55(59)45-30-18-9-19-31-45)49(58)52(48(64-40)39-63-68(57(3,4)5,46-32-20-10-21-33-46)47-34-22-11-23-35-47)67-56-54(62-38-44-28-16-8-17-29-44)53(61-37-43-26-14-7-15-27-43)51(41(2)65-56)60-36-42-24-12-6-13-25-42/h6-35,40-41,48-54,56,58H,36-39H2,1-5H3 |
| InChIKey | OXTBZUWGXMBKLW-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.22 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|