C26H38O4Si — CID 101378992
(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal (PubChem CID 101378992) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal.
| Compound Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal |
|---|---|
| PubChem CID | 101378992 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal |
| SMILES | CC(C)O[C@H](C=O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(C)C |
| InChI | InChI=1S/C26H38O4Si/c1-20(2)29-24(18-27)25(30-21(3)4)19-28-31(26(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-18,20-21,24-25H,19H2,1-7H3/t24-,25-/m1/s1 |
| InChIKey | JFTOLEGFLXMPBO-JWQCQUIFSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|