C28H36O2Si2 — CID 102380302
tert-butyl-[(Z,4S)-3-ethynyl-4-methoxy-6-trimethylsilylhex-2-en-5-ynoxy]-diphenylsilane (PubChem CID 102380302) has the molecular formula C28H36O2Si2 and a molecular weight of 460.77 g/mol. Its IUPAC name is tert-butyl-[(Z,4S)-3-ethynyl-4-methoxy-6-trimethylsilylhex-2-en-5-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z,4S)-3-ethynyl-4-methoxy-6-trimethylsilylhex-2-en-5-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102380302 |
| Molecular Formula | C28H36O2Si2 |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | tert-butyl-[(Z,4S)-3-ethynyl-4-methoxy-6-trimethylsilylhex-2-en-5-ynoxy]-diphenylsilane |
| SMILES | C#C/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)OC |
| InChI | InChI=1S/C28H36O2Si2/c1-9-24(27(29-5)21-23-31(6,7)8)20-22-30-32(28(2,3)4,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h1,10-20,27H,22H2,2-8H3/b24-20-/t27-/m1/s1 |
| InChIKey | LPKDCYXHZAFSAW-HNMPSHKWSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|