C27H36O3Si — CID 102211153
[(E,2S)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-yl] hex-5-enoate (PubChem CID 102211153) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is [(E,2S)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-yl] hex-5-enoate.
| Compound Name | [(E,2S)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-yl] hex-5-enoate |
|---|---|
| PubChem CID | 102211153 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(E,2S)-5-[tert-butyl(diphenyl)silyl]oxypent-3-en-2-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H](C)/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O3Si/c1-6-7-10-21-26(28)30-23(2)16-15-22-29-31(27(3,4)5,24-17-11-8-12-18-24)25-19-13-9-14-20-25/h6,8-9,11-20,23H,1,7,10,21-22H2,2-5H3/b16-15+/t23-/m0/s1 |
| InChIKey | NJAMXAFSIUJBDR-TVXVBNPNSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|