C46H48Br2OSi2 — CID 142646296
[2-[(3-bromophenyl)methyl]phenyl]-[[2-[(3-bromophenyl)methyl]phenyl]-tert-butyl-phenylsilyl]oxy-tert-butyl-phenylsilane (PubChem CID 142646296) has the molecular formula C46H48Br2OSi2 and a molecular weight of 832.87 g/mol. Its IUPAC name is [2-[(3-bromophenyl)methyl]phenyl]-[[2-[(3-bromophenyl)methyl]phenyl]-tert-butyl-phenylsilyl]oxy-tert-butyl-phenylsilane.
| Compound Name | [2-[(3-bromophenyl)methyl]phenyl]-[[2-[(3-bromophenyl)methyl]phenyl]-tert-butyl-phenylsilyl]oxy-tert-butyl-phenylsilane |
|---|---|
| PubChem CID | 142646296 |
| Molecular Formula | C46H48Br2OSi2 |
| Molecular Weight | 832.87 g/mol |
| Exact Mass | 830.16 |
| IUPAC Name | [2-[(3-bromophenyl)methyl]phenyl]-[[2-[(3-bromophenyl)methyl]phenyl]-tert-butyl-phenylsilyl]oxy-tert-butyl-phenylsilane |
| SMILES | CC(C)(C)[Si](O[Si](c1ccccc1)(c1ccccc1Cc1cccc(Br)c1)C(C)(C)C)(c1ccccc1)c1ccccc1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C46H48Br2OSi2/c1-45(2,3)50(41-25-9-7-10-26-41,43-29-15-13-21-37(43)31-35-19-17-23-39(47)33-35)49-51(46(4,5)6,42-27-11-8-12-28-42)44-30-16-14-22-38(44)32-36-20-18-24-40(48)34-36/h7-30,33-34H,31-32H2,1-6H3 |
| InChIKey | USLMOFXNYMGMSI-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.87 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|