C32H52O5Si2 — CID 11843470
(2R,3S,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methylnonanoic acid (PubChem CID 11843470) has the molecular formula C32H52O5Si2 and a molecular weight of 572.94 g/mol. Its IUPAC name is (2R,3S,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methylnonanoic acid.
| Compound Name | (2R,3S,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methylnonanoic acid |
|---|---|
| PubChem CID | 11843470 |
| Molecular Formula | C32H52O5Si2 |
| Molecular Weight | 572.94 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | (2R,3S,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-2-methylnonanoic acid |
| SMILES | C[C@@H](C[C@@H](O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H52O5Si2/c1-24(23-26(33)21-22-29(25(2)30(34)35)37-38(9,10)31(3,4)5)36-39(32(6,7)8,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-20,24-26,29,33H,21-23H2,1-10H3,(H,34,35)/t24-,25+,26-,29-/m0/s1 |
| InChIKey | QAWWYUPAZYEMQO-BVXNIFABSA-N |
| XLogP | 6.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.94 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|