C25H27O2P — CID 123539955
5-methoxy-4-methyl-1-(triphenyl-λ5-phosphanylidene)pentan-2-one (PubChem CID 123539955) has the molecular formula C25H27O2P and a molecular weight of 390.46 g/mol. Its IUPAC name is 5-methoxy-4-methyl-1-(triphenyl-λ5-phosphanylidene)pentan-2-one.
| Compound Name | 5-methoxy-4-methyl-1-(triphenyl-λ5-phosphanylidene)pentan-2-one |
|---|---|
| PubChem CID | 123539955 |
| Molecular Formula | C25H27O2P |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-methoxy-4-methyl-1-(triphenyl-λ5-phosphanylidene)pentan-2-one |
| SMILES | COCC(C)CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27O2P/c1-21(19-27-2)18-22(26)20-28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,20-21H,18-19H2,1-2H3 |
| InChIKey | HRMZNGKNARUANM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|