C34H45O4PS — CID 144775333
tert-butyl (3S)-3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 144775333) has the molecular formula C34H45O4PS and a molecular weight of 580.77 g/mol. Its IUPAC name is tert-butyl (3S)-3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 144775333 |
| Molecular Formula | C34H45O4PS |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1)OS(C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H45O4PS/c1-33(2,3)37-32(36)25-28(38-40(7,8)34(4,5)6)24-27(35)26-39(29-18-12-9-13-19-29,30-20-14-10-15-21-30)31-22-16-11-17-23-31/h9-23,26,28H,24-25H2,1-8H3/t28-/m0/s1 |
| InChIKey | YGHRUBQCZNKCNS-NDEPHWFRSA-N |
| XLogP | 6.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|