C16H21O5S+ — CID 90907290
tert-butyl (E)-3-methyl-5-phenoxysulfonylpent-4-enoate (PubChem CID 90907290) has the molecular formula C16H21O5S+ and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl (E)-3-methyl-5-phenoxysulfonylpent-4-enoate.
| Compound Name | tert-butyl (E)-3-methyl-5-phenoxysulfonylpent-4-enoate |
|---|---|
| PubChem CID | 90907290 |
| Molecular Formula | C16H21O5S+ |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | tert-butyl (E)-3-methyl-5-phenoxysulfonylpent-4-enoate |
| SMILES | [CH2+]C(/C=C/S(=O)(=O)Oc1ccccc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21O5S/c1-13(12-15(17)20-16(2,3)4)10-11-22(18,19)21-14-8-6-5-7-9-14/h5-11,13H,1,12H2,2-4H3/q+1/b11-10+ |
| InChIKey | RNWFVGJJEZPQAI-ZHACJKMWSA-N |
| XLogP | 3.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|