C22H29NO5S — CID 87296889
tert-butyl 4-amino-3-(4-methylsulfonyloxyphenyl)-5-phenylpentanoate (PubChem CID 87296889) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(4-methylsulfonyloxyphenyl)-5-phenylpentanoate.
| Compound Name | tert-butyl 4-amino-3-(4-methylsulfonyloxyphenyl)-5-phenylpentanoate |
|---|---|
| PubChem CID | 87296889 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | tert-butyl 4-amino-3-(4-methylsulfonyloxyphenyl)-5-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)CC(c1ccc(OS(C)(=O)=O)cc1)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO5S/c1-22(2,3)27-21(24)15-19(20(23)14-16-8-6-5-7-9-16)17-10-12-18(13-11-17)28-29(4,25)26/h5-13,19-20H,14-15,23H2,1-4H3 |
| InChIKey | IQYXPSGHUUGVRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|