C21H34O3 — CID 71048741
tert-butyl 3-tert-butyl-7-phenoxyheptanoate (PubChem CID 71048741) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is tert-butyl 3-tert-butyl-7-phenoxyheptanoate.
| Compound Name | tert-butyl 3-tert-butyl-7-phenoxyheptanoate |
|---|---|
| PubChem CID | 71048741 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | tert-butyl 3-tert-butyl-7-phenoxyheptanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCCCOc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H34O3/c1-20(2,3)17(16-19(22)24-21(4,5)6)12-10-11-15-23-18-13-8-7-9-14-18/h7-9,13-14,17H,10-12,15-16H2,1-6H3 |
| InChIKey | GFKAYAGNEOEOAY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|