C14H22N3O4PS — CID 135448703
1-diethoxyphosphinothioyl-3-(C-methyl-N-phenylmethoxycarbonimidoyl)urea (PubChem CID 135448703) has the molecular formula C14H22N3O4PS and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-diethoxyphosphinothioyl-3-(C-methyl-N-phenylmethoxycarbonimidoyl)urea.
| Compound Name | 1-diethoxyphosphinothioyl-3-(C-methyl-N-phenylmethoxycarbonimidoyl)urea |
|---|---|
| PubChem CID | 135448703 |
| Molecular Formula | C14H22N3O4PS |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-diethoxyphosphinothioyl-3-(C-methyl-N-phenylmethoxycarbonimidoyl)urea |
| SMILES | CCOP(=S)(NC(=O)NC(C)=NOCc1ccccc1)OCC |
| InChI | InChI=1S/C14H22N3O4PS/c1-4-20-22(23,21-5-2)17-14(18)15-12(3)16-19-11-13-9-7-6-8-10-13/h6-10H,4-5,11H2,1-3H3,(H2,15,16,17,18,23) |
| InChIKey | VPVDKIKSHMMXHN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|