C28H32NO7P — CID 15475475
[(1R,2R)-2-benzamido-1-diethoxyphosphoryl-2-phenylethyl] (2S)-2-methoxy-2-phenylacetate (PubChem CID 15475475) has the molecular formula C28H32NO7P and a molecular weight of 525.54 g/mol. Its IUPAC name is [(1R,2R)-2-benzamido-1-diethoxyphosphoryl-2-phenylethyl] (2S)-2-methoxy-2-phenylacetate.
| Compound Name | [(1R,2R)-2-benzamido-1-diethoxyphosphoryl-2-phenylethyl] (2S)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 15475475 |
| Molecular Formula | C28H32NO7P |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [(1R,2R)-2-benzamido-1-diethoxyphosphoryl-2-phenylethyl] (2S)-2-methoxy-2-phenylacetate |
| SMILES | CCOP(=O)(OCC)[C@@H](OC(=O)[C@@H](OC)c1ccccc1)[C@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32NO7P/c1-4-34-37(32,35-5-2)28(36-27(31)25(33-3)22-17-11-7-12-18-22)24(21-15-9-6-10-16-21)29-26(30)23-19-13-8-14-20-23/h6-20,24-25,28H,4-5H2,1-3H3,(H,29,30)/t24-,25+,28-/m1/s1 |
| InChIKey | GUDFTTOMVNZKCP-CERRFVOPSA-N |
| XLogP | 5.68 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|