C24H30FO6PS — CID 23051709
2-diethoxyphosphoryl-3-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]sulfanyl-4-methylpentanoic acid (PubChem CID 23051709) has the molecular formula C24H30FO6PS and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]sulfanyl-4-methylpentanoic acid.
| Compound Name | 2-diethoxyphosphoryl-3-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]sulfanyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23051709 |
| Molecular Formula | C24H30FO6PS |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-diethoxyphosphoryl-3-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]sulfanyl-4-methylpentanoic acid |
| SMILES | CCOP(=O)(OCC)C(C(=O)O)C(SC(C(=O)c1ccc(F)cc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H30FO6PS/c1-5-30-32(29,31-6-2)21(24(27)28)22(16(3)4)33-23(18-10-8-7-9-11-18)20(26)17-12-14-19(25)15-13-17/h7-16,21-23H,5-6H2,1-4H3,(H,27,28) |
| InChIKey | LKJKZAKCGWDGHZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|