C15H24NO8P — CID 21142135
4-(2-diethoxyphosphoryl-3-ethoxy-1-hydroxy-3-oxopropyl)-N-hydroxybenzeneamine oxide (PubChem CID 21142135) has the molecular formula C15H24NO8P and a molecular weight of 377.33 g/mol. Its IUPAC name is 4-(2-diethoxyphosphoryl-3-ethoxy-1-hydroxy-3-oxopropyl)-N-hydroxybenzeneamine oxide.
| Compound Name | 4-(2-diethoxyphosphoryl-3-ethoxy-1-hydroxy-3-oxopropyl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21142135 |
| Molecular Formula | C15H24NO8P |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-(2-diethoxyphosphoryl-3-ethoxy-1-hydroxy-3-oxopropyl)-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)C(C(O)c1ccc([NH+]([O-])O)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H24NO8P/c1-4-22-15(18)14(25(21,23-5-2)24-6-3)13(17)11-7-9-12(10-8-11)16(19)20/h7-10,13-14,16-17,19H,4-6H2,1-3H3 |
| InChIKey | IJIBPHVYHOHTFP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|