C20H17F2NO2 — CID 23573503
2-(2,5-difluorophenyl)-N-(2-hydroxy-1-naphthalen-2-ylethyl)acetamide (PubChem CID 23573503) has the molecular formula C20H17F2NO2 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N-(2-hydroxy-1-naphthalen-2-ylethyl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)-N-(2-hydroxy-1-naphthalen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 23573503 |
| Molecular Formula | C20H17F2NO2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N-(2-hydroxy-1-naphthalen-2-ylethyl)acetamide |
| SMILES | O=C(Cc1cc(F)ccc1F)NC(CO)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17F2NO2/c21-17-7-8-18(22)16(10-17)11-20(25)23-19(12-24)15-6-5-13-3-1-2-4-14(13)9-15/h1-10,19,24H,11-12H2,(H,23,25) |
| InChIKey | WFBJZURUWDXXTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |