C18H38N4O4Si2 — CID 10693954
2-trimethylsilylethyl N-[(E)-[(5E)-5-(2-trimethylsilylethoxycarbonylhydrazinylidene)hexan-2-ylidene]amino]carbamate (PubChem CID 10693954) has the molecular formula C18H38N4O4Si2 and a molecular weight of 430.70 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(E)-[(5E)-5-(2-trimethylsilylethoxycarbonylhydrazinylidene)hexan-2-ylidene]amino]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(E)-[(5E)-5-(2-trimethylsilylethoxycarbonylhydrazinylidene)hexan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 10693954 |
| Molecular Formula | C18H38N4O4Si2 |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-trimethylsilylethyl N-[(E)-[(5E)-5-(2-trimethylsilylethoxycarbonylhydrazinylidene)hexan-2-ylidene]amino]carbamate |
| SMILES | C/C(CC/C(C)=N/NC(=O)OCC[Si](C)(C)C)=N\NC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H38N4O4Si2/c1-15(19-21-17(23)25-11-13-27(3,4)5)9-10-16(2)20-22-18(24)26-12-14-28(6,7)8/h9-14H2,1-8H3,(H,21,23)(H,22,24)/b19-15+,20-16+ |
| InChIKey | VUWDIPJUULHPCY-MXWIWYRXSA-N |
| XLogP | 4.65 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|